2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester
Modify Date: 2026-09-20 06:51:27
2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester structure
|
Common Name | 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 91284-09-2 | Molecular Weight | 234.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18O3 |
|---|---|
| Molecular Weight | 234.29100 |
| Exact Mass | 234.12600 |
| PSA | 35.53000 |
| LogP | 2.67820 |
| InChIKey | JFLBIJJMEVSLDJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CCc2ccc(OC)cc21 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 2-(6'-methoxy-2',3'-dihydro-1'H-inden-1'-yl)acetate |
| (6-methoxy-indan-1-yl)-acetic acid ethyl ester |
| (6-Methoxy-indan-1yl)-acetic acid ethyl ester |
| ethyl (6-methoxyindan-1-yl)acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester? |
| A: CAS number of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester is 91284-09-2. |
| Q: What is the LogP of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester? |
| A: LogP of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester is 2.67820. |
| Q: What is the English name of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester? |
| A: The English name of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester is 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester. |
| Q: What is the molecular weight of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester? |
| A: Molecular weight of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester is 234.29100. |
| Q: What is the SMILES notation of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester? |
| A: SMILES notation of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester is CCOC(=O)CC1CCc2ccc(OC)cc21. |
| Q: What is the InChIKey of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester? |
| A: InChIKey of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester is JFLBIJJMEVSLDJ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester? |
| A: Polar surface area (PSA) of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester is 35.53000. |
| Q: What English synonyms does 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester have? |
| A: English synonyms of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester: ethyl 2-(6'-methoxy-2',3'-dihydro-1'H-inden-1'-yl)acetate, (6-methoxy-indan-1-yl)-acetic acid ethyl ester, (6-Methoxy-indan-1yl)-acetic acid ethyl ester, ethyl (6-methoxyindan-1-yl)acetate. |
| Q: What is the Chinese name of 91284-09-2? |
| A: Chinese name of 91284-09-2 is 91284-09-2. |
| Q: What is the molecular formula of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester? |
| A: Molecular formula of 2,3-dihydro-6-methoxy-1H-indene-1-acetic acid ethyl ester is C14H18O3. |