Urea,N-(2-methylphenyl)-N'-[3-(trifluoromethyl)phenyl]- structure
|
Common Name | Urea,N-(2-methylphenyl)-N'-[3-(trifluoromethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 91286-91-8 | Molecular Weight | 294.27200 | |
| Density | 1.339g/cm3 | Boiling Point | 284.6ºC at 760 mmHg | |
| Molecular Formula | C15H13F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.9ºC | |
| Name | 1-(2-methylphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 284.6ºC at 760 mmHg |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.27200 |
| Flash Point | 125.9ºC |
| Exact Mass | 294.09800 |
| PSA | 41.13000 |
| LogP | 4.80380 |
| Index of Refraction | 1.597 |
| InChIKey | PUQBXRKJAINERF-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1NC(=O)Nc1cccc(C(F)(F)F)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |