4-[2-(carboxymethyl)-6,6-dimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indol-1-yl]benzoic acid
Modify Date: 2025-09-13 16:48:20
![4-[2-(carboxymethyl)-6,6-dimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indol-1-yl]benzoic acid Structure](https://www.chemsrc.com/extcaspic/004/912909-75-2.png)
4-[2-(carboxymethyl)-6,6-dimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indol-1-yl]benzoic acid structure
|
Common Name | 4-[2-(carboxymethyl)-6,6-dimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indol-1-yl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 912909-75-2 | Molecular Weight | 341.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(carboxymethyl)-6,6-dimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indol-1-yl]benzoic acid |
|---|
| Molecular Formula | C19H19NO5 |
|---|---|
| Molecular Weight | 341.4 |
| InChIKey | KWEFIWRFXFCYAP-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)c2cc(CC(=O)O)n(-c3ccc(C(=O)O)cc3)c2C1 |
|
Name: Inhibition of human c-Myc assessed as reduction in c-Myc/Max/Ebox DNA complex formati...
Source: ChEMBL
Target: Myc proto-oncogene protein
External Id: CHEMBL4476912
|
|
Name: Cytotoxic activity against human NCI-H2171 cells assessed as reduction in cell viabil...
Source: ChEMBL
Target: NCI-H2171
External Id: CHEMBL4476913
|
|
Name: Cytotoxic activity against human MM1S cells assessed as reduction in cell viability i...
Source: ChEMBL
Target: MM1.S
External Id: CHEMBL4476914
|
Total 3, Current Page 1 of 1
1