4-[(2-amino-6-chloro-pyrimidin-4-yl)amino]-2-(hydroxymethyl)cyclopentan-1-ol structure
|
Common Name | 4-[(2-amino-6-chloro-pyrimidin-4-yl)amino]-2-(hydroxymethyl)cyclopentan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 91296-08-1 | Molecular Weight | 258.70500 | |
| Density | 1.522g/cm3 | Boiling Point | 578.6ºC at 760 mmHg | |
| Molecular Formula | C10H15ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.7ºC | |
| Name | 4-[(2-amino-6-chloropyrimidin-4-yl)amino]-2-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.522g/cm3 |
|---|---|
| Boiling Point | 578.6ºC at 760 mmHg |
| Molecular Formula | C10H15ClN4O2 |
| Molecular Weight | 258.70500 |
| Flash Point | 303.7ºC |
| Exact Mass | 258.08800 |
| PSA | 104.29000 |
| LogP | 0.91010 |
| Index of Refraction | 1.696 |
| InChIKey | DOIIZKLGFABNKV-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)cc(NC2CC(O)C(CO)C2)n1 |
|
~46%
4-[(2-amino-6-c... CAS#:91296-08-1 |
| Literature: Shealy, Y. Fulmer; O'Dell, C. Allen; Shannon, W. M.; Arnett, Gussie Journal of Medicinal Chemistry, 1984 , vol. 27, # 11 p. 1416 - 1421 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-[(2-amino-6-chloropyrimidin-4-yl)amino]-2-(hydroxymethyl)cyclopentanol |
| 4-[(2-amino-6-chloro-pyrimidin-4-yl)amino]-2-(hydroxymethyl)cyclopentan-1-ol |