6H-Purin-6-one,2-amino-1,9-dihydro-9-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-,rel- structure
|
Common Name | 6H-Purin-6-one,2-amino-1,9-dihydro-9-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-,rel- | ||
|---|---|---|---|---|
| CAS Number | 91296-12-7 | Molecular Weight | 265.26900 | |
| Density | 1.92g/cm3 | Boiling Point | 656.3ºC at 760mmHg | |
| Molecular Formula | C11H15N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 350.7ºC | |
| Name | 2-amino-9-[3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3H-purin-6-one |
|---|
| Density | 1.92g/cm3 |
|---|---|
| Boiling Point | 656.3ºC at 760mmHg |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.26900 |
| Flash Point | 350.7ºC |
| Exact Mass | 265.11700 |
| PSA | 130.05000 |
| Index of Refraction | 1.881 |
| InChIKey | ZEKJSNVOQKQOFO-UHFFFAOYSA-N |
| SMILES | Nc1nc2c(ncn2C2CC(O)C(CO)C2)c(=O)[nH]1 |
|
~32%
6H-Purin-6-one,... CAS#:91296-12-7 |
| Literature: Shealy, Y. Fulmer; O'Dell, C. Allen; Shannon, W. M.; Arnett, Gussie Journal of Medicinal Chemistry, 1984 , vol. 27, # 11 p. 1416 - 1421 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |