2-amino-9-[3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3H-purine-6-thione structure
|
Common Name | 2-amino-9-[3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3H-purine-6-thione | ||
|---|---|---|---|---|
| CAS Number | 91296-13-8 | Molecular Weight | 281.33400 | |
| Density | 1.88g/cm3 | Boiling Point | 647.1ºC at 760 mmHg | |
| Molecular Formula | C11H15N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.1ºC | |
| Name | 2-amino-9-[3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3H-purine-6-thione |
|---|
| Density | 1.88g/cm3 |
|---|---|
| Boiling Point | 647.1ºC at 760 mmHg |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.33400 |
| Flash Point | 345.1ºC |
| Exact Mass | 281.09500 |
| PSA | 145.07000 |
| LogP | 0.95660 |
| Index of Refraction | 1.904 |
| InChIKey | AJXWRHSYGALQIU-UHFFFAOYSA-N |
| SMILES | Nc1nc(=S)c2ncn(C3CC(O)C(CO)C3)c2[nH]1 |
|
~70%
2-amino-9-[3-hy... CAS#:91296-13-8 |
| Literature: Shealy, Y. Fulmer; O'Dell, C. Allen; Shannon, W. M.; Arnett, Gussie Journal of Medicinal Chemistry, 1984 , vol. 27, # 11 p. 1416 - 1421 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |