4-(3-amino-5-chloro-2,4,7,8,9-pentazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)-2-(hydroxymethyl)cyclopentan-1-ol structure
|
Common Name | 4-(3-amino-5-chloro-2,4,7,8,9-pentazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)-2-(hydroxymethyl)cyclopentan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 91311-05-6 | Molecular Weight | 284.70200 | |
| Density | 2.05g/cm3 | Boiling Point | 641.5ºC at 760 mmHg | |
| Molecular Formula | C10H13ClN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.8ºC | |
| Name | 4-(5-amino-7-chlorotriazolo[4,5-d]pyrimidin-3-yl)-2-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.05g/cm3 |
|---|---|
| Boiling Point | 641.5ºC at 760 mmHg |
| Molecular Formula | C10H13ClN6O2 |
| Molecular Weight | 284.70200 |
| Flash Point | 341.8ºC |
| Exact Mass | 284.07900 |
| PSA | 122.97000 |
| LogP | 0.34240 |
| Index of Refraction | 1.919 |
| InChIKey | AAPYTIHMITVQNC-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)c2nnn(C3CC(O)C(CO)C3)c2n1 |
|
~55%
4-(3-amino-5-ch... CAS#:91311-05-6 |
| Literature: Shealy, Y. Fulmer; O'Dell, C. Allen; Shannon, W. M.; Arnett, Gussie Journal of Medicinal Chemistry, 1984 , vol. 27, # 11 p. 1416 - 1421 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 4-(5-amino-7-chloro-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl)-2-(hydroxymethyl)cyclopentanol |