4-Nitro-1H-inden-2(3H)-one structure
|
Common Name | 4-Nitro-1H-inden-2(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 913297-09-3 | Molecular Weight | 177.15700 | |
| Density | 1.396 g/cm3 | Boiling Point | 332.9ºC at 760 mmHg | |
| Molecular Formula | C9H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.4ºC | |
| Name | 4-Nitro-1H-inden-2(3H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396 g/cm3 |
|---|---|
| Boiling Point | 332.9ºC at 760 mmHg |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.15700 |
| Flash Point | 170.4ºC |
| Exact Mass | 177.04300 |
| PSA | 62.89000 |
| LogP | 1.78570 |
| InChIKey | AZJBBXINNYUQEO-UHFFFAOYSA-N |
| SMILES | O=C1Cc2cccc([N+](=O)[O-])c2C1 |
| HS Code | 2914700090 |
|---|
|
~%
4-Nitro-1H-inde... CAS#:913297-09-3 |
| Literature: US2006/241296 A1, ; Page/Page column 40 ; US 20060241296 A1 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-nitro-1,3-dihydroinden-2-one |