Benzenamine, 2-bromo-4,6-dinitro-N-phenyl- structure
|
Common Name | Benzenamine, 2-bromo-4,6-dinitro-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 91330-95-9 | Molecular Weight | 338.11400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8BrN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-4,6-dinitro-N-phenylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8BrN3O4 |
|---|---|
| Molecular Weight | 338.11400 |
| Exact Mass | 336.97000 |
| PSA | 103.67000 |
| LogP | 5.12850 |
| InChIKey | GGNFTBUSSNQONZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)c(Nc2ccccc2)c([N+](=O)[O-])c1 |
|
~%
Benzenamine, 2-... CAS#:91330-95-9 |
| Literature: Sane; Joshi Journal of the Chemical Society, 1924 , vol. 125, p. 2483 |
|
~%
Benzenamine, 2-... CAS#:91330-95-9 |
| Literature: Sane; Joshi Journal of the Chemical Society, 1924 , vol. 125, p. 2483 |
|
~%
Detail
|
| Literature: Sane; Joshi Journal of the Chemical Society, 1924 , vol. 125, p. 2483 |
| (2-Brom-4,6-dinitro-phenyl)-phenyl-amin |
| Benzenamine,2-bromo-4,6-dinitro-N-phenyl |
| (2-bromo-4,6-dinitro-phenyl)-phenyl-amine |
| 6-Brom-2.4-dinitro-diphenylamin |
| N-Phenyl-6-brom-2.4-dinitro-anilin |
| GNF-Pf-3641 |