1-chloro-2-nitro-4-phenylbenzene structure
|
Common Name | 1-chloro-2-nitro-4-phenylbenzene | ||
|---|---|---|---|---|
| CAS Number | 91331-25-8 | Molecular Weight | 233.65000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-2-nitro-4-phenylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8ClNO2 |
|---|---|
| Molecular Weight | 233.65000 |
| Exact Mass | 233.02400 |
| PSA | 45.82000 |
| LogP | 4.43840 |
| InChIKey | FIQBDKFALPAHOK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(-c2ccccc2)ccc1Cl |
|
~%
1-chloro-2-nitr... CAS#:91331-25-8 |
| Literature: Greizerstein,W. et al. Journal of the American Chemical Society, 1962 , vol. 84, p. 1026 - 1032 |
| 4-Chlor-3-nitro-biphenyl |
| 4-Chloro-3-nitrobiphenyl |
| 1,1'-Biphenyl,4-chloro-3-nitro |