D-Arabinose, 5-O-(triphenylmethyl)-,diethyl dithioacetal (9CI) structure
|
Common Name | D-Arabinose, 5-O-(triphenylmethyl)-,diethyl dithioacetal (9CI) | ||
|---|---|---|---|---|
| CAS Number | 91414-41-4 | Molecular Weight | 498.69700 | |
| Density | 1.217g/cm3 | Boiling Point | 705.8ºC at 760 mmHg | |
| Molecular Formula | C28H34O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 380.6ºC | |
| Name | 5-O-triphenylmethyl-D-arabinose diethyl dithioacetal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 705.8ºC at 760 mmHg |
| Molecular Formula | C28H34O4S2 |
| Molecular Weight | 498.69700 |
| Flash Point | 380.6ºC |
| Exact Mass | 498.19000 |
| PSA | 120.52000 |
| LogP | 4.91010 |
| Index of Refraction | 1.617 |
| InChIKey | CKEBMKMLRTUUMD-UHFFFAOYSA-N |
| SMILES | CCSC(SCC)C(O)C(O)C(O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~82%
D-Arabinose, 5-... CAS#:91414-41-4 |
| Literature: Tadano, Kin-ichi; Maeda, Hiroo; Hoshino, Masahide; Iimura, Youichi; Suami, Tetsuo Journal of Organic Chemistry, 1987 , vol. 52, # 10 p. 1946 - 1956 |
|
~%
D-Arabinose, 5-... CAS#:91414-41-4 |
| Literature: Bristow; Lythgoe Journal of the Chemical Society, 1949 , p. 2306,2308 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2'-Deoxy-5'-O-trityl-cytidin |
| 5-O-trityl-D-arabinose diethyl dithioacetal |
| O5'-trityl-2'-deoxy-cytidine |
| O5-Trityl-D-arabinose-diaethyldithioacetal |
| O5-trityl-D-arabinose-diethyldithioacetal |
| O5'-Trityl-2'-desoxy-cytidin |
| 5'-O-trityl-2'-deoxycytidine |
| 1,1-BIS(ETHYLSULFANYL)-5-(TRITYLOXY)PENTANE-2,3,4-TRIOL(NON-PREFERRED NAME) |
| 2'-deoxy-5'-O-tritylcytidine |