4-propan-2-yl-2-(trifluoromethyl)pyrimidine-5-carboxylic acid
Modify Date: 2025-08-25 15:50:50
4-propan-2-yl-2-(trifluoromethyl)pyrimidine-5-carboxylic acid structure
|
Common Name | 4-propan-2-yl-2-(trifluoromethyl)pyrimidine-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 914201-22-2 | Molecular Weight | 234.17500 | |
| Density | 1.361g/cm3 | Boiling Point | 254.4ºC at 760 mmHg | |
| Molecular Formula | C9H9F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.6ºC | |
| Name | 4-propan-2-yl-2-(trifluoromethyl)pyrimidine-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 254.4ºC at 760 mmHg |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.17500 |
| Flash Point | 107.6ºC |
| Exact Mass | 234.06200 |
| PSA | 63.08000 |
| LogP | 2.31700 |
| Index of Refraction | 1.476 |
| InChIKey | GAKSCPNNFHCXNW-UHFFFAOYSA-N |
| SMILES | CC(C)c1nc(C(F)(F)F)ncc1C(=O)O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-isopropyl-2-trifluoromethylpyrimidine-5-carboxylic acid |