7-chloro-1-(6-chloropyridin-3-yl)heptan-1-one
Modify Date: 2025-08-24 11:01:01
7-chloro-1-(6-chloropyridin-3-yl)heptan-1-one structure
|
Common Name | 7-chloro-1-(6-chloropyridin-3-yl)heptan-1-one | ||
|---|---|---|---|---|
| CAS Number | 914203-41-1 | Molecular Weight | 260.16000 | |
| Density | 1.182g/cm3 | Boiling Point | 397.2ºC at 760 mmHg | |
| Molecular Formula | C12H15Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | 7-chloro-1-(6-chloropyridin-3-yl)heptan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 397.2ºC at 760 mmHg |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16000 |
| Flash Point | 194ºC |
| Exact Mass | 259.05300 |
| PSA | 29.96000 |
| LogP | 4.10700 |
| Index of Refraction | 1.523 |
| InChIKey | UHMGOCDSIOVUCS-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCCl)c1ccc(Cl)nc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-5-(7-chloroheptanoyl)pyridine |