2-(4-chlorophenyl)-2-piperidin-1-ylethanamine
Modify Date: 2025-08-25 11:46:39
2-(4-chlorophenyl)-2-piperidin-1-ylethanamine structure
|
Common Name | 2-(4-chlorophenyl)-2-piperidin-1-ylethanamine | ||
|---|---|---|---|---|
| CAS Number | 914207-57-1 | Molecular Weight | 238.75600 | |
| Density | 1.144g/cm3 | Boiling Point | 338.1ºC at 760 mmHg | |
| Molecular Formula | C13H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3ºC | |
| Name | 2-(4-chlorophenyl)-2-piperidin-1-ylethanamine |
|---|
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 338.1ºC at 760 mmHg |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.75600 |
| Flash Point | 158.3ºC |
| Exact Mass | 238.12400 |
| PSA | 29.26000 |
| LogP | 3.46390 |
| Index of Refraction | 1.573 |
| InChIKey | SUBRFDLWSDKKPS-UHFFFAOYSA-N |
| SMILES | NCC(c1ccc(Cl)cc1)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |