5,8-Quinolinedione,6-amino-7-(methylthio)- structure
|
Common Name | 5,8-Quinolinedione,6-amino-7-(methylthio)- | ||
|---|---|---|---|---|
| CAS Number | 91426-36-7 | Molecular Weight | 220.24800 | |
| Density | 1.45g/cm3 | Boiling Point | 373.3ºC at 760 mmHg | |
| Molecular Formula | C10H8N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.6ºC | |
| Name | 6-amino-7-methylsulfanylquinoline-5,8-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 373.3ºC at 760 mmHg |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.24800 |
| Flash Point | 179.6ºC |
| Exact Mass | 220.03100 |
| PSA | 98.35000 |
| LogP | 1.69420 |
| Index of Refraction | 1.678 |
| InChIKey | FZZUEOHBJUAKKN-UHFFFAOYSA-N |
| SMILES | CSC1=C(N)C(=O)c2cccnc2C1=O |
|
~76%
5,8-Quinolinedi... CAS#:91426-36-7 |
| Literature: Mulchin, Benjamin J.; Newton, Christopher G.; Baty, James W.; Grasso, Carole H.; Martin, William John; Walton, Michaela C.; Dangerfield, Emma M.; Plunkett, Catherine H.; Berridge, Michael V.; Harper, Jacquie L.; Timmer, Mattie S.M.; Stocker, Bridget L. Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 9 p. 3238 - 3251 |
|
~%
5,8-Quinolinedi... CAS#:91426-36-7 |
| Literature: Schellhammer; Petersen Justus Liebigs Annalen der Chemie, 1959 , vol. 624, p. 108,114, 119 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6-amino-7-methylsulfanyl-5,8-quinolinequinone |
| 6-Amino-7-methylmercapto-chinolin-5,8-dion |