ethyl 1-[4-(hydroxymethyl)phenyl]piperidine-4-carboxylate structure
|
Common Name | ethyl 1-[4-(hydroxymethyl)phenyl]piperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 914349-50-1 | Molecular Weight | 263.33200 | |
| Density | 1.146g/cm3 | Boiling Point | 422ºC at 760 mmHg | |
| Molecular Formula | C15H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209ºC | |
| Name | ethyl 1-[4-(hydroxymethyl)phenyl]piperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 422ºC at 760 mmHg |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.33200 |
| Flash Point | 209ºC |
| Exact Mass | 263.15200 |
| PSA | 49.77000 |
| LogP | 2.02340 |
| Index of Refraction | 1.549 |
| InChIKey | NINDVACLWGXYSY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(c2ccc(CO)cc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-Hydroxymethylphenyl)piperidine-4-carboxylic acid ethyl ester |
| Ethyl 1-(4-(hydroxymethyl)phenyl)piperidine-4-carboxylate |