2-Bromo-1-(2,6-dichloro-3-fluorophenyl)ethan-1-one structure
|
Common Name | 2-Bromo-1-(2,6-dichloro-3-fluorophenyl)ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 914635-49-7 | Molecular Weight | 285.92500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4BrCl2FO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Bromo-1-(2,6-dichloro-3-fluorophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H4BrCl2FO |
|---|---|
| Molecular Weight | 285.92500 |
| Exact Mass | 283.88100 |
| PSA | 17.07000 |
| LogP | 3.71010 |
| InChIKey | QFVUFUXFUVITSO-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1c(Cl)ccc(F)c1Cl |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD09038425 |