4-Iodo-3-(trifluoromethyl)benzoic acid structure
|
Common Name | 4-Iodo-3-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 914636-20-7 | Molecular Weight | 316.01600 | |
| Density | N/A | Boiling Point | 311.7±42.0°C at 760 mmHg | |
| Molecular Formula | C8H4F3IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Iodo-3-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 311.7±42.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C8H4F3IO2 |
| Molecular Weight | 316.01600 |
| Exact Mass | 315.92100 |
| PSA | 37.30000 |
| LogP | 3.00820 |
| InChIKey | TZAMLJCNESLFDI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(I)c(C(F)(F)F)c1 |
| HS Code | 2916399090 |
|---|
|
~84%
4-Iodo-3-(trifl... CAS#:914636-20-7 |
| Literature: ELI LILLY AND COMPANY Patent: WO2007/140174 A2, 2007 ; Location in patent: Page/Page column 42 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| PC9306 |
| 4-iodo-3-trifluoromethyl-benzoic acid |