Einecs 293-837-8
Modify Date: 2026-08-15 20:41:50
Einecs 293-837-8 structure
|
Common Name | Einecs 293-837-8 | ||
|---|---|---|---|---|
| CAS Number | 91464-39-0 | Molecular Weight | 935.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H57N5O22 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Einecs 293-837-8 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C38H57N5O22 |
|---|---|
| Molecular Weight | 935.9 |
| InChIKey | ILJZRDSZTWILBY-MJJUKVHASA-N |
| SMILES | NCCC(O)C(=O)NC1CC(NC(=O)c2cc3ccc(OC4OC(CO)C(O)C(O)C4O)cc3oc2=O)C(OC2OC(CO)C(O)C(N)C2O)C(O)C1OC1OC(CN)C(O)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 91464-39-0? |
| A: Chinese name of 91464-39-0 is 91464-39-0. |
| Q: What is the InChIKey of Einecs 293-837-8? |
| A: InChIKey of Einecs 293-837-8 is ILJZRDSZTWILBY-MJJUKVHASA-N. |
| Q: What is the molecular weight of Einecs 293-837-8? |
| A: Molecular weight of Einecs 293-837-8 is 935.9. |
| Q: What is the SMILES notation of Einecs 293-837-8? |
| A: SMILES notation of Einecs 293-837-8 is NCCC(O)C(=O)NC1CC(NC(=O)c2cc3ccc(OC4OC(CO)C(O)C(O)C4O)cc3oc2=O)C(OC2OC(CO)C(O)C(N)C2O)C(O)C1OC1OC(CN)C(O)C(O)C1O. |
| Q: What is the CAS number of Einecs 293-837-8? |
| A: CAS number of Einecs 293-837-8 is 91464-39-0. |
| Q: What is the molecular formula of Einecs 293-837-8? |
| A: Molecular formula of Einecs 293-837-8 is C38H57N5O22. |
| Q: What is the English name of Einecs 293-837-8? |
| A: The English name of Einecs 293-837-8 is Einecs 293-837-8. |