ethyl 3-(diethylaminomethyl)-1H-indole-2-carboxylate structure
|
Common Name | ethyl 3-(diethylaminomethyl)-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 91486-86-1 | Molecular Weight | 274.35800 | |
| Density | 1.115g/cm3 | Boiling Point | 418.7ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207ºC | |
| Name | 3-Diethylaminomethyl-2-thioxo-benzthiazolin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 418.7ºC at 760 mmHg |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.35800 |
| Flash Point | 207ºC |
| Exact Mass | 274.16800 |
| PSA | 45.33000 |
| LogP | 3.18640 |
| Index of Refraction | 1.582 |
| InChIKey | KZYIPFFTBMSUIP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1CN(CC)CC |
|
~%
ethyl 3-(diethy... CAS#:91486-86-1 |
| Literature: Kissman; Witkop Journal of the American Chemical Society, 1953 , vol. 75, p. 1967,1971 |
| 3-Diaethylaminomethyl-indol-2-carbonsaeure-aethylester |
| 3-Diaethylaminomethyl-3H-benzothiazol-2-thion |
| 3-Diethylaminomethyl-benzothiazolyl-2-thion |
| 3-diethylaminomethyl-indole-2-carboxylic acid ethyl ester |
| 3-Diethylaminomethyl-2-thioxobenzothiazol |