Irloxacin structure
|
Common Name | Irloxacin | ||
|---|---|---|---|---|
| CAS Number | 91524-15-1 | Molecular Weight | 300.28400 | |
| Density | 1.36g/cm3 | Boiling Point | 495.9ºC at 760mmHg | |
| Molecular Formula | C16H13FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7ºC | |
Use of IrloxacinIrloxacin (Pirfloxacin) is a quinolone antibacterial agent. Irloxacin shows greater activity with an acid pH. Irloxacin has a good in vitro antimicrobial spectrum against both gram-positive and gram-negative bacteria. Orally active[1]. |
| Name | 1-ethyl-6-fluoro-4-oxo-7-pyrrol-1-ylquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Irloxacin (Pirfloxacin) is a quinolone antibacterial agent. Irloxacin shows greater activity with an acid pH. Irloxacin has a good in vitro antimicrobial spectrum against both gram-positive and gram-negative bacteria. Orally active[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 495.9ºC at 760mmHg |
| Molecular Formula | C16H13FN2O3 |
| Molecular Weight | 300.28400 |
| Flash Point | 253.7ºC |
| Exact Mass | 300.09100 |
| PSA | 64.23000 |
| LogP | 2.64940 |
| Index of Refraction | 1.634 |
| InChIKey | RZLHGQLYNZQZQQ-UHFFFAOYSA-N |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(-n3cccc3)cc21 |
| Storage condition | -20°C |
| Irloxacin |
| 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1H-pyrrol-1-yl)-3-quinolinecarboxylic acid |
| Pirfloxacin |
| Irloxacinum [Latin] |
| Irloxacino [Spanish] |
| pirflossacina |
| 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-pyrrolyl)-3-quinolinecarboxylic acid |
| 6-fluoro-7-(1-pyrrolyl)-1-ethyl-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid |
| Irloxacine [French] |
| E-3432 |