(E,E)-2,4-Heptadienyldiphenylphosphine Oxide structure
|
Common Name | (E,E)-2,4-Heptadienyldiphenylphosphine Oxide | ||
|---|---|---|---|---|
| CAS Number | 91575-92-7 | Molecular Weight | 296.34300 | |
| Density | 1.06g/cm3 | Boiling Point | 408.8ºC at 760 mmHg | |
| Molecular Formula | C19H21OP | Melting Point | 101-103ºC | |
| MSDS | N/A | Flash Point | 201.1ºC | |
| Name | (E,E)-2,4-Heptadienyldiphenylphosphine Oxide |
|---|
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 408.8ºC at 760 mmHg |
| Melting Point | 101-103ºC |
| Molecular Formula | C19H21OP |
| Molecular Weight | 296.34300 |
| Flash Point | 201.1ºC |
| Exact Mass | 296.13300 |
| PSA | 26.88000 |
| LogP | 4.52290 |
| Index of Refraction | 1.565 |
| InChIKey | VZPNYAAYIKMMRT-ZDHPXMGNSA-N |
| SMILES | CCC=CC=CCP(=O)(c1ccccc1)c1ccccc1 |
|
~%
(E,E)-2,4-Hepta... CAS#:91575-92-7 |
| Literature: Journal of the Chemical Society, Chemical Communications, , # 6 p. 349 - 350 |
|
~%
(E,E)-2,4-Hepta... CAS#:91575-92-7 |
| Literature: Journal of the Chemical Society, Chemical Communications, , # 6 p. 349 - 350 |
|
~%
(E,E)-2,4-Hepta... CAS#:91575-92-7 |
| Literature: Journal of the Chemical Society, Chemical Communications, , # 6 p. 349 - 350 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |