2-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)acetic acid structure
|
Common Name | 2-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 915919-78-7 | Molecular Weight | 156.13900 | |
| Density | 1.314g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.13900 |
| Exact Mass | 156.05300 |
| PSA | 85.95000 |
| Index of Refraction | 1.515 |
| InChIKey | PHEYRMKCBVDPSN-UHFFFAOYSA-N |
| SMILES | Cc1[nH][nH]c(=O)c1CC(=O)O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bb_sc-1242 |