2-naphthalen-2-ylpyrimidine-5-carbaldehyde structure
|
Common Name | 2-naphthalen-2-ylpyrimidine-5-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 915919-99-2 | Molecular Weight | 234.25300 | |
| Density | 1.253g/cm3 | Boiling Point | 349.1ºC at 760 mmHg | |
| Molecular Formula | C15H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169ºC | |
| Name | 2-naphthalen-2-ylpyrimidine-5-carbaldehyde |
|---|
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 349.1ºC at 760 mmHg |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.25300 |
| Flash Point | 169ºC |
| Exact Mass | 234.07900 |
| PSA | 42.85000 |
| LogP | 3.10930 |
| Index of Refraction | 1.692 |
| InChIKey | PEPUDGUDPHYAEY-UHFFFAOYSA-N |
| SMILES | O=Cc1cnc(-c2ccc3ccccc3c2)nc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |