4-(2,5-diMethylphenyl)-5-propyl-1,3-thiazol-2-aMine
Modify Date: 2025-08-25 21:25:33
4-(2,5-diMethylphenyl)-5-propyl-1,3-thiazol-2-aMine structure
|
Common Name | 4-(2,5-diMethylphenyl)-5-propyl-1,3-thiazol-2-aMine | ||
|---|---|---|---|---|
| CAS Number | 915920-38-6 | Molecular Weight | 246.37100 | |
| Density | 1.111g/cm3 | Boiling Point | 395.9ºC at 760 mmHg | |
| Molecular Formula | C14H18N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.2ºC | |
| Name | 4-(2,5-diMethylphenyl)-5-propyl-1,3-thiazol-2-aMine |
|---|
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 395.9ºC at 760 mmHg |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.37100 |
| Flash Point | 193.2ºC |
| Exact Mass | 246.11900 |
| PSA | 67.15000 |
| LogP | 4.54280 |
| Index of Refraction | 1.595 |
| InChIKey | JPNWXDMIUJSCCS-UHFFFAOYSA-N |
| SMILES | CCCc1sc(N)nc1-c1cc(C)ccc1C |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |