2-amino-5-methyl-6-propyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one structure
|
Common Name | 2-amino-5-methyl-6-propyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one | ||
|---|---|---|---|---|
| CAS Number | 915921-28-7 | Molecular Weight | 207.23200 | |
| Density | 1.5g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H13N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-5-methyl-6-propyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|
| Density | 1.5g/cm3 |
|---|---|
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.23200 |
| Exact Mass | 207.11200 |
| PSA | 89.33000 |
| LogP | 1.25420 |
| Index of Refraction | 1.72 |
| InChIKey | WXSYDPOEQVVXSO-UHFFFAOYSA-N |
| SMILES | CCCc1c(C)nc2nc(N)[nH]n2c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |