(4-bromophenyl)-(1H-imidazol-2-yl)methanone structure
|
Common Name | (4-bromophenyl)-(1H-imidazol-2-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 915921-68-5 | Molecular Weight | 251.07900 | |
| Density | 1.617g/cm3 | Boiling Point | 434.852ºC at 760 mmHg | |
| Molecular Formula | C10H7BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.791ºC | |
| Name | (4-bromophenyl)-(1H-imidazol-2-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.617g/cm3 |
|---|---|
| Boiling Point | 434.852ºC at 760 mmHg |
| Molecular Formula | C10H7BrN2O |
| Molecular Weight | 251.07900 |
| Flash Point | 216.791ºC |
| Exact Mass | 249.97400 |
| PSA | 45.75000 |
| LogP | 2.40320 |
| Index of Refraction | 1.645 |
| InChIKey | JEBOSSBCWOPJLB-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Br)cc1)c1ncc[nH]1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-bromophenyl imidazol-2-yl ketone |