ethyl 2-[(5-formylpyrimidin-2-yl)-methylamino]acetate
Modify Date: 2025-09-19 18:29:14
![ethyl 2-[(5-formylpyrimidin-2-yl)-methylamino]acetate Structure](https://image.chemsrc.com/caspic/050/915921-80-1.png)
ethyl 2-[(5-formylpyrimidin-2-yl)-methylamino]acetate structure
|
Common Name | ethyl 2-[(5-formylpyrimidin-2-yl)-methylamino]acetate | ||
|---|---|---|---|---|
| CAS Number | 915921-80-1 | Molecular Weight | 223.22900 | |
| Density | 1.25g/cm3 | Boiling Point | 376.1ºC at 760 mmHg | |
| Molecular Formula | C10H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.2ºC | |
| Name | ethyl 2-[(5-formylpyrimidin-2-yl)-methylamino]acetate |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 376.1ºC at 760 mmHg |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.22900 |
| Flash Point | 181.2ºC |
| Exact Mass | 223.09600 |
| PSA | 72.39000 |
| LogP | 0.28840 |
| Index of Refraction | 1.577 |
| InChIKey | VIKHMEKAWKJJEM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN(C)c1ncc(C=O)cn1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |