2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetic acid
Modify Date: 2025-08-23 18:51:32
2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetic acid structure
|
Common Name | 2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 915921-98-1 | Molecular Weight | 228.62900 | |
| Density | 1.449g/cm3 | Boiling Point | 388ºC at 760 mmHg | |
| Molecular Formula | C10H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.4ºC | |
| Name | 2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetic acid |
|---|
| Density | 1.449g/cm3 |
|---|---|
| Boiling Point | 388ºC at 760 mmHg |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.62900 |
| Flash Point | 188.4ºC |
| Exact Mass | 228.01900 |
| PSA | 55.76000 |
| LogP | 1.73830 |
| Index of Refraction | 1.587 |
| InChIKey | LGLSIVKEHGQKRR-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc2c(cc1Cl)OCCO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |