2-chloro-N-(3-pyrrolidin-1-ylphenyl)acetamide
Modify Date: 2025-09-25 09:38:42
2-chloro-N-(3-pyrrolidin-1-ylphenyl)acetamide structure
|
Common Name | 2-chloro-N-(3-pyrrolidin-1-ylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 915921-99-2 | Molecular Weight | 238.71300 | |
| Density | 1.266g/cm3 | Boiling Point | 449.7ºC at 760 mmHg | |
| Molecular Formula | C12H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.8ºC | |
| Name | 2-chloro-N-(3-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 449.7ºC at 760 mmHg |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.71300 |
| Flash Point | 225.8ºC |
| Exact Mass | 238.08700 |
| PSA | 35.83000 |
| LogP | 3.17860 |
| Index of Refraction | 1.612 |
| InChIKey | FKUPPGKBFIBLNA-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1cccc(N2CCCC2)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chloro-N-[3-(1-pyrrolidinyl)phenyl]acetamide |