[5-(3-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazine structure
|
Common Name | [5-(3-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazine | ||
|---|---|---|---|---|
| CAS Number | 915922-25-7 | Molecular Weight | 217.22700 | |
| Density | 1.316g/cm3 | Boiling Point | 457.2ºC at 760 mmHg | |
| Molecular Formula | C10H11N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.3ºC | |
| Name | [5-(3-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazine |
|---|
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 457.2ºC at 760 mmHg |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.22700 |
| Flash Point | 230.3ºC |
| Exact Mass | 217.09600 |
| PSA | 85.95000 |
| LogP | 1.60610 |
| Index of Refraction | 1.651 |
| InChIKey | VFQKUNUNUMFNQG-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2cnnc(NN)n2)c1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |