3-chloro-N-(3,5-dimethoxyphenyl)propanamide structure
|
Common Name | 3-chloro-N-(3,5-dimethoxyphenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 915923-51-2 | Molecular Weight | 243.68700 | |
| Density | 1.228g/cm3 | Boiling Point | 425.6ºC at 760 mmHg | |
| Molecular Formula | C11H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.2ºC | |
| Name | 3-chloro-N-(3,5-dimethoxyphenyl)propanamide |
|---|
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 425.6ºC at 760 mmHg |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.68700 |
| Flash Point | 211.2ºC |
| Exact Mass | 243.06600 |
| PSA | 47.56000 |
| LogP | 2.34420 |
| Index of Refraction | 1.551 |
| InChIKey | FWJIKACTNJJWAJ-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)CCCl)cc(OC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |