3-(cyclopentanecarbonylamino)-4-methylbenzoic acid
Modify Date: 2025-09-22 17:34:12
3-(cyclopentanecarbonylamino)-4-methylbenzoic acid structure
|
Common Name | 3-(cyclopentanecarbonylamino)-4-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 915923-57-8 | Molecular Weight | 247.29000 | |
| Density | 1.261g/cm3 | Boiling Point | 479.632ºC at 760 mmHg | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.873ºC | |
| Name | 3-(cyclopentanecarbonylamino)-4-methylbenzoic acid |
|---|
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 479.632ºC at 760 mmHg |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29000 |
| Flash Point | 243.873ºC |
| Exact Mass | 247.12100 |
| PSA | 66.40000 |
| LogP | 2.89490 |
| Index of Refraction | 1.616 |
| InChIKey | FTTAGXIQQDJSMF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)C1CCCC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |