CAY10648 structure
|
Common Name | CAY10648 | ||
|---|---|---|---|---|
| CAS Number | 916048-02-7 | Molecular Weight | 350.797 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 637.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H19ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339.1±31.5 °C | |
Use of CAY10648CAY10648 is an intermediate used in the synthesis of potent DP2 receptor antagonists based on a novel spiro-indolinone compound. |
| Name | tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,3'-pyrrolidine]-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 637.1±55.0 °C at 760 mmHg |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.797 |
| Flash Point | 339.1±31.5 °C |
| Exact Mass | 350.103333 |
| PSA | 75.71000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | FXDFCQKNBUKFLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)C2(CCNC2=O)c2cc(Cl)ccc21 |
|
~29%
CAY10648 CAS#:916048-02-7 |
| Literature: APPLIED RESEARCH SYSTEMS ARS HOLDING N.V. Patent: WO2006/125784 A1, 2006 ; Location in patent: Page/Page column 76-77 ; WO 2006/125784 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Spiro[3H-indole-3,3'-pyrrolidine]-1(2H)-acetic acid, 5-chloro-2,2'-dioxo-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl (5-chloro-2,2'-dioxospiro[indole-3,3'-pyrrolidin]-1(2H)-yl)acetate |