tert-Butyl 2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate structure
|
Common Name | tert-Butyl 2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 916420-27-4 | Molecular Weight | 304.172 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 423.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H15Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.7±28.7 °C | |
| Name | tert-Butyl 2,4-dichloro-5,6-dihydropyrido[3,4-d]pyrimidine-7(8H)-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 423.1±45.0 °C at 760 mmHg |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.172 |
| Flash Point | 209.7±28.7 °C |
| Exact Mass | 303.054138 |
| PSA | 55.32000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | SAEOMPAQDWZLHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(Cl)nc(Cl)nc2C1 |
| HS Code | 2933990090 |
|---|
|
~%
tert-Butyl 2,4-... CAS#:916420-27-4 |
| Literature: WO2014/15291 A1, ; |
|
~%
tert-Butyl 2,4-... CAS#:916420-27-4 |
| Literature: WO2014/15291 A1, ; |
|
~%
tert-Butyl 2,4-... CAS#:916420-27-4 |
| Literature: WO2014/15291 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 2,4-dichloro-5,8-dihydropyrido[3,4-d]pyrimidine-7(6H)-carboxylate |
| Pyrido[3,4-d]pyrimidine-7(6H)-carboxylic acid, 2,4-dichloro-5,8-dihydro-, 1,1-dimethylethyl ester |
| tert-butyl 2,4-dichloro-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| tert-Butyl 2,4-dichloro-5,8-dihydropyrido[3,4-d]pyrimidine-7(6H)-carboxylate |