3-methyl-5-(trifluoromethoxy)benzoic acid structure
|
Common Name | 3-methyl-5-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 916420-51-4 | Molecular Weight | 220.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-5-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7F3O3 |
|---|---|
| Molecular Weight | 220.14500 |
| Exact Mass | 220.03500 |
| PSA | 46.53000 |
| LogP | 2.59180 |
| InChIKey | OCLLNMRZSFBMBJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(OC(F)(F)F)cc(C(=O)O)c1 |
| HS Code | 2918990090 |
|---|
|
~%
3-methyl-5-(tri... CAS#:916420-51-4 |
| Literature: ARENA PHARMACEUTICALS, INC. Patent: WO2009/78983 A1, 2009 ; Location in patent: Page/Page column 101 ; WO 2009/078983 A1 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-methyl-3-(trifluoromethoxy)benzoic acid |
| PC3603 |