Benzenepropanoic acid, 3-methyl-5-(trifluoromethoxy) structure
|
Common Name | Benzenepropanoic acid, 3-methyl-5-(trifluoromethoxy) | ||
|---|---|---|---|---|
| CAS Number | 916420-57-0 | Molecular Weight | 248.19800 | |
| Density | 1.305±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 298.0±35.0 °C (760 mmHg) | |
| Molecular Formula | C11H11F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzenepropanoic acid, 3-methyl-5-(trifluoromethoxy) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 298.0±35.0 °C (760 mmHg) |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.19800 |
| Exact Mass | 248.06600 |
| PSA | 46.53000 |
| LogP | 2.91080 |
| InChIKey | LEZTWHDBDSJSTN-UHFFFAOYSA-N |
| SMILES | Cc1cc(CCC(=O)O)cc(OC(F)(F)F)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-[3-methyl-5-(trifluoromethoxy)phenyl]propionic acid |