Benzeneacetic acid, 4-methoxy-2-(trifluoromethyl)
Modify Date: 2025-06-18 14:26:56
Benzeneacetic acid, 4-methoxy-2-(trifluoromethyl) structure
|
Common Name | Benzeneacetic acid, 4-methoxy-2-(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 916420-90-1 | Molecular Weight | 234.17200 | |
| Density | 1.342±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 295.5±40.0 °C (760 mmHg) | |
| Molecular Formula | C10H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzeneacetic acid, 4-methoxy-2-(trifluoromethyl) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 295.5±40.0 °C (760 mmHg) |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17200 |
| Exact Mass | 234.05000 |
| PSA | 46.53000 |
| LogP | 2.34110 |
| InChIKey | ZAOJHEOIUQVOEU-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)O)c(C(F)(F)F)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Methoxy-2-(trifluoromethyl)phenylacetic acid |
| 4-Methoxy-2-trifluoromethylphenylacetic acid |