glutaric acid-2-methylamino-5-nitromonoanilide
glutaric acid-2-methylamino-5-nitromonoanilide structure
|
Common Name | glutaric acid-2-methylamino-5-nitromonoanilide | ||
|---|---|---|---|---|
| CAS Number | 91644-13-2 | Molecular Weight | 281.265 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 582.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H15N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.8±30.1 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 582.1±50.0 °C at 760 mmHg |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.265 |
| Flash Point | 305.8±30.1 °C |
| Exact Mass | 281.101166 |
| PSA | 127.74000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | IEBOWQSCVIKQHZ-UHFFFAOYSA-N |
| SMILES | CNc1ccc([N+](=O)[O-])cc1NC(=O)CCCC(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-{[2-(Methylamino)-5-nitrophenyl]amino}-5-oxopentanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid? |
| A: LogP of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid is 1.93. |
| Q: What is the molecular formula of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid? |
| A: Molecular formula of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid is C12H15N3O5. |
| Q: What is the SMILES notation of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid? |
| A: SMILES notation of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid is CNc1ccc([N+](=O)[O-])cc1NC(=O)CCCC(=O)O. |
| Q: What is the English name of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid? |
| A: The English name of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid is 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid. |
| Q: What English synonyms does 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid have? |
| A: English synonyms of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid: 5-{[2-(Methylamino)-5-nitrophenyl]amino}-5-oxopentanoic acid. |
| Q: What is the molecular weight of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid? |
| A: Molecular weight of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid is 281.265. |
| Q: What is the boiling point of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid? |
| A: Boiling point of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid is 582.1±50.0 °C at 760 mmHg. |
| Q: What is the CAS number of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid? |
| A: CAS number of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid is 91644-13-2. |
| Q: What is the InChIKey of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid? |
| A: InChIKey of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid is IEBOWQSCVIKQHZ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid? |
| A: Polar surface area (PSA) of 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid is 127.74000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |