glutaric acid-2-methylamino-5-nitromonoanilide structure
|
Common Name | glutaric acid-2-methylamino-5-nitromonoanilide | ||
|---|---|---|---|---|
| CAS Number | 91644-13-2 | Molecular Weight | 281.265 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 582.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H15N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.8±30.1 °C | |
| Name | 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 582.1±50.0 °C at 760 mmHg |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.265 |
| Flash Point | 305.8±30.1 °C |
| Exact Mass | 281.101166 |
| PSA | 127.74000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | IEBOWQSCVIKQHZ-UHFFFAOYSA-N |
| SMILES | CNc1ccc([N+](=O)[O-])cc1NC(=O)CCCC(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-{[2-(Methylamino)-5-nitrophenyl]amino}-5-oxopentanoic acid |