1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl)
Modify Date: 2026-07-04 08:36:08
1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl) structure
|
Common Name | 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl) | ||
|---|---|---|---|---|
| CAS Number | 916575-07-0 | Molecular Weight | 443.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14INO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14INO4S |
|---|---|
| Molecular Weight | 443.3 |
| InChIKey | PYTQXPRZEJSKBQ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(cc(I)n2S(=O)(=O)c2ccccc2)c1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl)? |
| A: Molecular formula of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl) is C16H14INO4S. |
| Q: What is the English name of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl)? |
| A: The English name of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl) is 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl). |
| Q: What is the CAS number of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl)? |
| A: CAS number of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl) is 916575-07-0. |
| Q: What is the SMILES notation of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl)? |
| A: SMILES notation of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl) is COc1ccc2c(cc(I)n2S(=O)(=O)c2ccccc2)c1OC. |
| Q: What is the Chinese name of 916575-07-0? |
| A: Chinese name of 916575-07-0 is 916575-07-0. |
| Q: What is the InChIKey of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl)? |
| A: InChIKey of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl) is PYTQXPRZEJSKBQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl)? |
| A: Molecular weight of 1h-Indole,2-iodo-4,5-dimethoxy-1-(phenylsulfonyl) is 443.3. |