4-(1-methylpyrazol-3-yl)benzenesulfonyl chloride structure
|
Common Name | 4-(1-methylpyrazol-3-yl)benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 916766-81-9 | Molecular Weight | 256.70900 | |
| Density | 1.41g/cm3 | Boiling Point | 397.1ºC at 760 mmHg | |
| Molecular Formula | C10H9ClN2O2S | Melting Point | 89.5-91ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1-methylpyrazol-3-yl)benzenesulfonyl chloride |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 397.1ºC at 760 mmHg |
| Melting Point | 89.5-91ºC |
| Molecular Formula | C10H9ClN2O2S |
| Molecular Weight | 256.70900 |
| Exact Mass | 256.00700 |
| PSA | 60.34000 |
| LogP | 3.09540 |
| Index of Refraction | 1.634 |
| InChIKey | PXFXKTMOZHYJJU-UHFFFAOYSA-N |
| SMILES | Cn1ccc(-c2ccc(S(=O)(=O)Cl)cc2)n1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |