3-hydroxy-5-(prop-2-enoxycarbonylamino)benzoic acid structure
|
Common Name | 3-hydroxy-5-(prop-2-enoxycarbonylamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 916766-99-9 | Molecular Weight | 237.20900 | |
| Density | 1.412g/cm3 | Boiling Point | 398.9ºC at 760 mmHg | |
| Molecular Formula | C11H11NO5 | Melting Point | 194.5ºC | |
| MSDS | N/A | Flash Point | 195ºC | |
| Name | 3-hydroxy-5-(prop-2-enoxycarbonylamino)benzoic acid |
|---|
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 398.9ºC at 760 mmHg |
| Melting Point | 194.5ºC |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.20900 |
| Flash Point | 195ºC |
| Exact Mass | 237.06400 |
| PSA | 95.86000 |
| LogP | 1.89790 |
| Index of Refraction | 1.634 |
| InChIKey | MYOCYAGTJQROGX-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)Nc1cc(O)cc(C(=O)O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |