3,4-diamino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,7,9-triazabicyclo[4.3.0]nona-2,7,10-trien-5-one structure
|
Common Name | 3,4-diamino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,7,9-triazabicyclo[4.3.0]nona-2,7,10-trien-5-one | ||
|---|---|---|---|---|
| CAS Number | 91713-22-3 | Molecular Weight | 297.26700 | |
| Density | 2.12g/cm3 | Boiling Point | 773.4ºC at 760 mmHg | |
| Molecular Formula | C11H15N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 421.6ºC | |
| Name | 5,6-diamino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazo[4,5-c]pyridin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.12g/cm3 |
|---|---|
| Boiling Point | 773.4ºC at 760 mmHg |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.26700 |
| Flash Point | 421.6ºC |
| Exact Mass | 297.10700 |
| PSA | 161.78000 |
| Index of Refraction | 1.903 |
| InChIKey | UTVYRLCIIIIABF-MGUDNFKCSA-N |
| SMILES | Nc1cc2c(ncn2C2OC(CO)C(O)C2O)c(=O)n1N |
|
~75%
3,4-diamino-9-[... CAS#:91713-22-3 |
| Literature: Revankar, Ganapathi R.; Gupta, Pranab K.; Adams, Alexander D.; Dalley, N. Kent; McKernan, Patricia A.; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 11 p. 1389 - 1396 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-amino-3-deazaguanosine |