9H-Purine,9,9'-(1,3-propanediyl)bis[6-chloro- structure
|
Common Name | 9H-Purine,9,9'-(1,3-propanediyl)bis[6-chloro- | ||
|---|---|---|---|---|
| CAS Number | 91719-24-3 | Molecular Weight | 349.17800 | |
| Density | 1.77g/cm3 | Boiling Point | 601.7ºC at 760 mmHg | |
| Molecular Formula | C13H10Cl2N8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.7ºC | |
| Name | 6-chloro-9-[3-(6-chloropurin-9-yl)propyl]purine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.77g/cm3 |
|---|---|
| Boiling Point | 601.7ºC at 760 mmHg |
| Molecular Formula | C13H10Cl2N8 |
| Molecular Weight | 349.17800 |
| Flash Point | 317.7ºC |
| Exact Mass | 348.04100 |
| PSA | 87.20000 |
| LogP | 2.36310 |
| Index of Refraction | 1.849 |
| InChIKey | IJQPUAHUVABTDE-UHFFFAOYSA-N |
| SMILES | Clc1ncnc2c1ncn2CCCn1cnc2c(Cl)ncnc21 |
|
~66%
9H-Purine,9,9'-... CAS#:91719-24-3 |
| Literature: Parkanyi, Cyril; Yuan, Hui Liang; Marin-Montes, Martha C.; Essoussi, Hans T. Collection of Czechoslovak Chemical Communications, 1991 , vol. 56, # 11.1 p. 2382 - 2388 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,3-Bis-<6-chlor-purinyl-(9)>-propan |
| 1,3-bis(6-chloro-9-purinyl)propane |
| 6,6'-dichloro-9H,9'H-9,9'-propane-1,3-diyl-bis-purine |