N-Boc-3-isopropylamino-propionic acid structure
|
Common Name | N-Boc-3-isopropylamino-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 917202-02-9 | Molecular Weight | 231.28900 | |
| Density | 1.071g/cm3 | Boiling Point | 332.2ºC at 760 mmHg | |
| Molecular Formula | C11H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.7ºC | |
| Name | N-Boc-3-isopropylamino-propionic acid |
|---|
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 332.2ºC at 760 mmHg |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.28900 |
| Flash Point | 154.7ºC |
| Exact Mass | 231.14700 |
| PSA | 66.84000 |
| LogP | 2.10660 |
| Index of Refraction | 1.467 |
| InChIKey | KKIAMBQPKZBCIZ-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCC(=O)O)C(=O)OC(C)(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |