9,10-dihydro-9,10-ethenoanthracen-11-yl triflate structure
|
Common Name | 9,10-dihydro-9,10-ethenoanthracen-11-yl triflate | ||
|---|---|---|---|---|
| CAS Number | 91759-14-7 | Molecular Weight | 352.32800 | |
| Density | 1.53g/cm3 | Boiling Point | 433.9ºC at 760 mmHg | |
| Molecular Formula | C17H11F3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | 9,10-dihydro-9,10-ethenoanthracen-11-yl triflate |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 433.9ºC at 760 mmHg |
| Molecular Formula | C17H11F3O3S |
| Molecular Weight | 352.32800 |
| Flash Point | 216.2ºC |
| Exact Mass | 352.03800 |
| PSA | 51.75000 |
| LogP | 5.10830 |
| Index of Refraction | 1.625 |
| InChIKey | IFLQYUWVKUMLBX-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OC1=CC2c3ccccc3C1c1ccccc12)C(F)(F)F |
|
~73%
9,10-dihydro-9,... CAS#:91759-14-7 |
| Literature: Ladika, Mladen; Stang, Peter J.; Schiavelli, Melvyn D.; Kowalski, Mark H. Journal of the American Chemical Society, 1984 , vol. 106, # 21 p. 6372 - 6375 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |