5-(4-METHOXY-PHENYL)-4-PHENYL-4H-[1,2,4]TRIAZOLE-3-THIOL structure
|
Common Name | 5-(4-METHOXY-PHENYL)-4-PHENYL-4H-[1,2,4]TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 91759-68-1 | Molecular Weight | 283.34800 | |
| Density | 1.27g/cm3 | Boiling Point | 402.8ºC at 760mmHg | |
| Molecular Formula | C15H13N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-methoxyphenyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 402.8ºC at 760mmHg |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.34800 |
| Exact Mass | 283.07800 |
| PSA | 78.74000 |
| LogP | 3.23160 |
| Index of Refraction | 1.662 |
| InChIKey | NUWCQEKKUKYOIE-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2n[nH]c(=S)n2-c2ccccc2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(4-methoxyphenyl)-4-phenyl-1,2,4-triazole-3-thiol |
| 5-(4-Methoxy-phenyl)-4-phenyl-2,4-dihydro-[1,2,4]triazole-3-thione |
| 5-(4-methoxy-phenyl)-4-phenyl-4h-[1,2,4]triazole-3-thiol |