2-chloro-5-(piperidin-1-ylcarbonyl)aniline structure
|
Common Name | 2-chloro-5-(piperidin-1-ylcarbonyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 91766-96-0 | Molecular Weight | 238.71300 | |
| Density | 1.265g/cm3 | Boiling Point | 428.328ºC at 760 mmHg | |
| Molecular Formula | C12H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.845ºC | |
| Name | (3-amino-4-chlorophenyl)-piperidin-1-ylmethanone |
|---|
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 428.328ºC at 760 mmHg |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.71300 |
| Flash Point | 212.845ºC |
| Exact Mass | 238.08700 |
| PSA | 46.33000 |
| LogP | 3.06740 |
| Index of Refraction | 1.61 |
| InChIKey | HASRYCYCAUWJKD-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(=O)N2CCCCC2)ccc1Cl |
| HS Code | 2933399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |