1-(1H-indol-2-ylmethyl)-3-phenylthiourea structure
|
Common Name | 1-(1H-indol-2-ylmethyl)-3-phenylthiourea | ||
|---|---|---|---|---|
| CAS Number | 917986-04-0 | Molecular Weight | 281.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1H-indol-2-ylmethyl)-3-phenylthiourea |
|---|
| Molecular Formula | C16H15N3S |
|---|---|
| Molecular Weight | 281.37500 |
| Exact Mass | 281.09900 |
| PSA | 78.98000 |
| LogP | 4.13880 |
| InChIKey | DCUMHAPLLFTWIF-UHFFFAOYSA-N |
| SMILES | S=C(NCc1cc2ccccc2[nH]1)Nc1ccccc1 |
|
~93%
1-(1H-indol-2-y... CAS#:917986-04-0 |
| Literature: Csomos, Peter; Zupko, Istvan; Rethy, Borbala; Fodor, Lajos; Falkay, George; Bernath, Gabor Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 24 p. 6273 - 6276 |
|
~%
1-(1H-indol-2-y... CAS#:917986-04-0 |
| Literature: Csomos, Peter; Zupko, Istvan; Rethy, Borbala; Fodor, Lajos; Falkay, George; Bernath, Gabor Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 24 p. 6273 - 6276 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |