3,5-dibromo-4-hydroxy-N-phenyl-benzamide structure
|
Common Name | 3,5-dibromo-4-hydroxy-N-phenyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 91805-70-8 | Molecular Weight | 371.02400 | |
| Density | 1.863g/cm3 | Boiling Point | 366.1ºC at 760 mmHg | |
| Molecular Formula | C13H9Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.2ºC | |
| Name | 3,5-dibromo-4-hydroxy-N-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.863g/cm3 |
|---|---|
| Boiling Point | 366.1ºC at 760 mmHg |
| Molecular Formula | C13H9Br2NO2 |
| Molecular Weight | 371.02400 |
| Flash Point | 175.2ºC |
| Exact Mass | 368.90000 |
| PSA | 49.33000 |
| LogP | 4.24250 |
| Index of Refraction | 1.713 |
| InChIKey | WMCDXGVCOXTBRC-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)c1cc(Br)c(O)c(Br)c1 |
|
~43%
3,5-dibromo-4-h... CAS#:91805-70-8 |
| Literature: Johnson, Steven M.; Connelly, Stephen; Wilson, Ian A.; Kelly, Jeffery W. Journal of Medicinal Chemistry, 2008 , vol. 51, # 20 p. 6348 - 6358 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,5-dibromo-4-hydroxy-N-phenyl-benzamide |
| 3,5-Dibrom-4-hydroxy-benzoesaeure-anilid |